C18H22FN3O3 — CID 56854266
(3S,5R,9R)-11-[(2-fluoro-5-methylphenyl)methyl]-5-hydroxy-1,7,11-triazatricyclo[7.4.0.03,7]tridecane-2,8-dione (PubChem CID 56854266) has the molecular formula C18H22FN3O3 and a molecular weight of 347.39 g/mol. Its IUPAC name is (3S,5R,9R)-11-[(2-fluoro-5-methylphenyl)methyl]-5-hydroxy-1,7,11-triazatricyclo[7.4.0.03,7]tridecane-2,8-dione.
| Compound Name | (3S,5R,9R)-11-[(2-fluoro-5-methylphenyl)methyl]-5-hydroxy-1,7,11-triazatricyclo[7.4.0.03,7]tridecane-2,8-dione |
|---|---|
| PubChem CID | 56854266 |
| Molecular Formula | C18H22FN3O3 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | (3S,5R,9R)-11-[(2-fluoro-5-methylphenyl)methyl]-5-hydroxy-1,7,11-triazatricyclo[7.4.0.03,7]tridecane-2,8-dione |
| SMILES | Cc1ccc(F)c(CN2CCN3C(=O)[C@@H]4C[C@@H](O)CN4C(=O)[C@H]3C2)c1 |
| InChI | InChI=1S/C18H22FN3O3/c1-11-2-3-14(19)12(6-11)8-20-4-5-21-16(10-20)18(25)22-9-13(23)7-15(22)17(21)24/h2-3,6,13,15-16,23H,4-5,7-10H2,1H3/t13-,15+,16-/m1/s1 |
| InChIKey | VJPVOXZEYCPBSP-VNQPRFMTSA-N |
| XLogP | 0.12 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |