C15H15Cl2N3O3 — CID 56854770
N-[(3R,7S,8aS)-3-methyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3,5-dichlorobenzamide (PubChem CID 56854770) has the molecular formula C15H15Cl2N3O3 and a molecular weight of 356.21 g/mol. Its IUPAC name is N-[(3R,7S,8aS)-3-methyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3,5-dichlorobenzamide.
| Compound Name | N-[(3R,7S,8aS)-3-methyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3,5-dichlorobenzamide |
|---|---|
| PubChem CID | 56854770 |
| Molecular Formula | C15H15Cl2N3O3 |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | N-[(3R,7S,8aS)-3-methyl-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3,5-dichlorobenzamide |
| SMILES | C[C@H]1NC(=O)[C@@H]2C[C@H](NC(=O)c3cc(Cl)cc(Cl)c3)CN2C1=O |
| InChI | InChI=1S/C15H15Cl2N3O3/c1-7-15(23)20-6-11(5-12(20)14(22)18-7)19-13(21)8-2-9(16)4-10(17)3-8/h2-4,7,11-12H,5-6H2,1H3,(H,18,22)(H,19,21)/t7-,11+,12+/m1/s1 |
| InChIKey | AYGDGLILVAPLAR-MKCWBWRRSA-N |
| XLogP | 1.21 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |