C22H37N3O2 — CID 56854813
3-[2-[2,2-bis(prop-2-enyl)piperidin-1-yl]-2-oxoethyl]-4-(2,2-dimethylpropyl)piperazin-2-one (PubChem CID 56854813) has the molecular formula C22H37N3O2 and a molecular weight of 375.56 g/mol. Its IUPAC name is 3-[2-[2,2-bis(prop-2-enyl)piperidin-1-yl]-2-oxoethyl]-4-(2,2-dimethylpropyl)piperazin-2-one.
| Compound Name | 3-[2-[2,2-bis(prop-2-enyl)piperidin-1-yl]-2-oxoethyl]-4-(2,2-dimethylpropyl)piperazin-2-one |
|---|---|
| PubChem CID | 56854813 |
| Molecular Formula | C22H37N3O2 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.29 |
| IUPAC Name | 3-[2-[2,2-bis(prop-2-enyl)piperidin-1-yl]-2-oxoethyl]-4-(2,2-dimethylpropyl)piperazin-2-one |
| SMILES | C=CCC1(CC=C)CCCCN1C(=O)CC1C(=O)NCCN1CC(C)(C)C |
| InChI | InChI=1S/C22H37N3O2/c1-6-10-22(11-7-2)12-8-9-14-25(22)19(26)16-18-20(27)23-13-15-24(18)17-21(3,4)5/h6-7,18H,1-2,8-17H2,3-5H3,(H,23,27) |
| InChIKey | AGNQAJUPQKJPNX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|