C16H18Cl2N4O4 — CID 56857656
1-[(3R,7S,8aS)-3-[(1S)-1-hydroxyethyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(2,4-dichlorophenyl)urea (PubChem CID 56857656) has the molecular formula C16H18Cl2N4O4 and a molecular weight of 401.25 g/mol. Its IUPAC name is 1-[(3R,7S,8aS)-3-[(1S)-1-hydroxyethyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(2,4-dichlorophenyl)urea.
| Compound Name | 1-[(3R,7S,8aS)-3-[(1S)-1-hydroxyethyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(2,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 56857656 |
| Molecular Formula | C16H18Cl2N4O4 |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 1-[(3R,7S,8aS)-3-[(1S)-1-hydroxyethyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-3-(2,4-dichlorophenyl)urea |
| SMILES | C[C@H](O)[C@H]1NC(=O)[C@@H]2C[C@H](NC(=O)Nc3ccc(Cl)cc3Cl)CN2C1=O |
| InChI | InChI=1S/C16H18Cl2N4O4/c1-7(23)13-15(25)22-6-9(5-12(22)14(24)21-13)19-16(26)20-11-3-2-8(17)4-10(11)18/h2-4,7,9,12-13,23H,5-6H2,1H3,(H,21,24)(H2,19,20,26)/t7-,9-,12-,13+/m0/s1 |
| InChIKey | DQHCPRGKZIBUQE-MPZLTGKNSA-N |
| XLogP | 0.96 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |