C21H21F2N3O3 — CID 56858334
(7S,9aR)-2-[(3,4-difluorophenyl)methyl]-7-[(4-hydroxyphenyl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 56858334) has the molecular formula C21H21F2N3O3 and a molecular weight of 401.41 g/mol. Its IUPAC name is (7S,9aR)-2-[(3,4-difluorophenyl)methyl]-7-[(4-hydroxyphenyl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (7S,9aR)-2-[(3,4-difluorophenyl)methyl]-7-[(4-hydroxyphenyl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 56858334 |
| Molecular Formula | C21H21F2N3O3 |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | (7S,9aR)-2-[(3,4-difluorophenyl)methyl]-7-[(4-hydroxyphenyl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | O=C1N[C@@H](Cc2ccc(O)cc2)C(=O)N2CCN(Cc3ccc(F)c(F)c3)C[C@H]12 |
| InChI | InChI=1S/C21H21F2N3O3/c22-16-6-3-14(9-17(16)23)11-25-7-8-26-19(12-25)20(28)24-18(21(26)29)10-13-1-4-15(27)5-2-13/h1-6,9,18-19,27H,7-8,10-12H2,(H,24,28)/t18-,19+/m0/s1 |
| InChIKey | AOVWECUYPOMNSS-RBUKOAKNSA-N |
| XLogP | 1.42 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |