About 5-phenyl-1,3,4-selenadiazol-2-amine
5-phenyl-1,3,4-selenadiazol-2-amine (PubChem CID 568594) has the molecular formula C8H7N3Se
and a molecular weight of 224.13 g/mol. Its IUPAC name is 5-phenyl-1,3,4-selenadiazol-2-amine.
Molecular Properties
| Compound Name | 5-phenyl-1,3,4-selenadiazol-2-amine |
| PubChem CID | 568594 |
| Molecular Formula | C8H7N3Se |
| Molecular Weight | 224.13 g/mol |
| Exact Mass | 224.98 |
| IUPAC Name | 5-phenyl-1,3,4-selenadiazol-2-amine |
| SMILES | Nc1nnc(-c2ccccc2)[se]1 |
| InChI | InChI=1S/C8H7N3Se/c9-8-11-10-7(12-8)6-4-2-1-3-5-6/h1-5H,(H2,9,11) |
| InChIKey | UICUUIUEMMMADF-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.13 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-phenyl-1,3,4-selenadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-1,3,4-selenadiazol-2-amine?
The IUPAC name of 5-phenyl-1,3,4-selenadiazol-2-amine (CID 568594) is 5-phenyl-1,3,4-selenadiazol-2-amine.
What is the SMILES notation for 5-phenyl-1,3,4-selenadiazol-2-amine?
The canonical SMILES for 5-phenyl-1,3,4-selenadiazol-2-amine is Nc1nnc(-c2ccccc2)[se]1.
What is the InChIKey of 5-phenyl-1,3,4-selenadiazol-2-amine?
The InChIKey is UICUUIUEMMMADF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3Se/c9-8-11-10-7(12-8)6-4-2-1-3-5-6/h1-5H,(H2,9,11).
What are the key properties of 5-phenyl-1,3,4-selenadiazol-2-amine?
5-phenyl-1,3,4-selenadiazol-2-amine has a molecular weight of 224.13 g/mol, XLogP of 0.78, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-1,3,4-selenadiazol-2-amine is sourced from PubChem (CID 568594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).