C16H28N2O — CID 56859443
5-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-1-methylazepan-2-one (PubChem CID 56859443) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is 5-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-1-methylazepan-2-one.
| Compound Name | 5-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-1-methylazepan-2-one |
|---|---|
| PubChem CID | 56859443 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | 5-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-1-methylazepan-2-one |
| SMILES | CN1CCC(N2CC[C@@H]3CCCC[C@H]3C2)CCC1=O |
| InChI | InChI=1S/C16H28N2O/c1-17-10-9-15(6-7-16(17)19)18-11-8-13-4-2-3-5-14(13)12-18/h13-15H,2-12H2,1H3/t13-,14-,15?/m0/s1 |
| InChIKey | ZEKQAOFTUDLDAW-ZYOSVBKOSA-N |
| XLogP | 2.51 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |