C19H28N4O2S — CID 56859495
(3R,7S,8aS)-3-methyl-7-[[5-(piperidin-1-ylmethyl)thiophen-2-yl]methylamino]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 56859495) has the molecular formula C19H28N4O2S and a molecular weight of 376.53 g/mol. Its IUPAC name is (3R,7S,8aS)-3-methyl-7-[[5-(piperidin-1-ylmethyl)thiophen-2-yl]methylamino]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | (3R,7S,8aS)-3-methyl-7-[[5-(piperidin-1-ylmethyl)thiophen-2-yl]methylamino]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 56859495 |
| Molecular Formula | C19H28N4O2S |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | (3R,7S,8aS)-3-methyl-7-[[5-(piperidin-1-ylmethyl)thiophen-2-yl]methylamino]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | C[C@H]1NC(=O)[C@@H]2C[C@H](NCc3ccc(CN4CCCCC4)s3)CN2C1=O |
| InChI | InChI=1S/C19H28N4O2S/c1-13-19(25)23-11-14(9-17(23)18(24)21-13)20-10-15-5-6-16(26-15)12-22-7-3-2-4-8-22/h5-6,13-14,17,20H,2-4,7-12H2,1H3,(H,21,24)/t13-,14+,17+/m1/s1 |
| InChIKey | VYPOOOXRKSIPAU-KEYYUXOJSA-N |
| XLogP | 1.31 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |