About methyl tetracyclo[3.3.0.02,4.03,6]oct-7-ene-4-carboxylate
methyl tetracyclo[3.3.0.02,4.03,6]oct-7-ene-4-carboxylate (PubChem CID 568595) has the molecular formula C10H10O2
and a molecular weight of 162.19 g/mol. Its IUPAC name is methyl tetracyclo[3.3.0.02,4.03,6]oct-7-ene-4-carboxylate.
Molecular Properties
| Compound Name | methyl tetracyclo[3.3.0.02,4.03,6]oct-7-ene-4-carboxylate |
| PubChem CID | 568595 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | methyl tetracyclo[3.3.0.02,4.03,6]oct-7-ene-4-carboxylate |
| SMILES | COC(=O)C12C3C4C=CC3C1C42 |
| InChI | InChI=1S/C10H10O2/c1-12-9(11)10-6-4-2-3-5(6)8(10)7(4)10/h2-8H,1H3 |
| InChIKey | ZYUUTDYDFBJIDO-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl tetracyclo[3.3.0.02,4.03,6]oct-7-ene-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl tetracyclo[3.3.0.02,4.03,6]oct-7-ene-4-carboxylate?
The IUPAC name of methyl tetracyclo[3.3.0.02,4.03,6]oct-7-ene-4-carboxylate (CID 568595) is methyl tetracyclo[3.3.0.02,4.03,6]oct-7-ene-4-carboxylate.
What is the SMILES notation for methyl tetracyclo[3.3.0.02,4.03,6]oct-7-ene-4-carboxylate?
The canonical SMILES for methyl tetracyclo[3.3.0.02,4.03,6]oct-7-ene-4-carboxylate is COC(=O)C12C3C4C=CC3C1C42.
What is the InChIKey of methyl tetracyclo[3.3.0.02,4.03,6]oct-7-ene-4-carboxylate?
The InChIKey is ZYUUTDYDFBJIDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2/c1-12-9(11)10-6-4-2-3-5(6)8(10)7(4)10/h2-8H,1H3.
What are the key properties of methyl tetracyclo[3.3.0.02,4.03,6]oct-7-ene-4-carboxylate?
methyl tetracyclo[3.3.0.02,4.03,6]oct-7-ene-4-carboxylate has a molecular weight of 162.19 g/mol, XLogP of 0.84, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl tetracyclo[3.3.0.02,4.03,6]oct-7-ene-4-carboxylate is sourced from PubChem (CID 568595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).