C22H27N5O4 — CID 56859722
N-[(3S,7S,8aS)-3-[(1R)-1-hydroxyethyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-1-phenyl-5-propylpyrazole-4-carboxamide (PubChem CID 56859722) has the molecular formula C22H27N5O4 and a molecular weight of 425.49 g/mol. Its IUPAC name is N-[(3S,7S,8aS)-3-[(1R)-1-hydroxyethyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-1-phenyl-5-propylpyrazole-4-carboxamide.
| Compound Name | N-[(3S,7S,8aS)-3-[(1R)-1-hydroxyethyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-1-phenyl-5-propylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 56859722 |
| Molecular Formula | C22H27N5O4 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | N-[(3S,7S,8aS)-3-[(1R)-1-hydroxyethyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-1-phenyl-5-propylpyrazole-4-carboxamide |
| SMILES | CCCc1c(C(=O)N[C@H]2C[C@H]3C(=O)N[C@@H]([C@@H](C)O)C(=O)N3C2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C22H27N5O4/c1-3-7-17-16(11-23-27(17)15-8-5-4-6-9-15)20(29)24-14-10-18-21(30)25-19(13(2)28)22(31)26(18)12-14/h4-6,8-9,11,13-14,18-19,28H,3,7,10,12H2,1-2H3,(H,24,29)(H,25,30)/t13-,14+,18+,19+/m1/s1 |
| InChIKey | XNYYONFCIZJCNV-WXRFYESLSA-N |
| XLogP | 0.40 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |