C21H22FN3O3 — CID 56860376
(7S,9aR)-2-[(2-fluorophenyl)methyl]-7-[(4-hydroxyphenyl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 56860376) has the molecular formula C21H22FN3O3 and a molecular weight of 383.42 g/mol. Its IUPAC name is (7S,9aR)-2-[(2-fluorophenyl)methyl]-7-[(4-hydroxyphenyl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (7S,9aR)-2-[(2-fluorophenyl)methyl]-7-[(4-hydroxyphenyl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 56860376 |
| Molecular Formula | C21H22FN3O3 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | (7S,9aR)-2-[(2-fluorophenyl)methyl]-7-[(4-hydroxyphenyl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | O=C1N[C@@H](Cc2ccc(O)cc2)C(=O)N2CCN(Cc3ccccc3F)C[C@H]12 |
| InChI | InChI=1S/C21H22FN3O3/c22-17-4-2-1-3-15(17)12-24-9-10-25-19(13-24)20(27)23-18(21(25)28)11-14-5-7-16(26)8-6-14/h1-8,18-19,26H,9-13H2,(H,23,27)/t18-,19+/m0/s1 |
| InChIKey | VJQQHXXPBJGRNT-RBUKOAKNSA-N |
| XLogP | 1.29 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |