C23H26N4O3S — CID 56860407
(7R,9aR)-N-benzyl-7-(benzylsulfanylmethyl)-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide (PubChem CID 56860407) has the molecular formula C23H26N4O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is (7R,9aR)-N-benzyl-7-(benzylsulfanylmethyl)-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide.
| Compound Name | (7R,9aR)-N-benzyl-7-(benzylsulfanylmethyl)-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 56860407 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | (7R,9aR)-N-benzyl-7-(benzylsulfanylmethyl)-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide |
| SMILES | O=C1N[C@@H](CSCc2ccccc2)C(=O)N2CCN(C(=O)NCc3ccccc3)C[C@H]12 |
| InChI | InChI=1S/C23H26N4O3S/c28-21-20-14-26(23(30)24-13-17-7-3-1-4-8-17)11-12-27(20)22(29)19(25-21)16-31-15-18-9-5-2-6-10-18/h1-10,19-20H,11-16H2,(H,24,30)(H,25,28)/t19-,20+/m0/s1 |
| InChIKey | PWSIELCRPWUZCC-VQTJNVASSA-N |
| XLogP | 1.84 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |