C19H25N3O3 — CID 56860437
N-[(3R,7S,8aS)-3-(2-methylpropyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-4-methylbenzamide (PubChem CID 56860437) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-[(3R,7S,8aS)-3-(2-methylpropyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-4-methylbenzamide.
| Compound Name | N-[(3R,7S,8aS)-3-(2-methylpropyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 56860437 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-[(3R,7S,8aS)-3-(2-methylpropyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N[C@H]2C[C@H]3C(=O)N[C@H](CC(C)C)C(=O)N3C2)cc1 |
| InChI | InChI=1S/C19H25N3O3/c1-11(2)8-15-19(25)22-10-14(9-16(22)18(24)21-15)20-17(23)13-6-4-12(3)5-7-13/h4-7,11,14-16H,8-10H2,1-3H3,(H,20,23)(H,21,24)/t14-,15+,16-/m0/s1 |
| InChIKey | PLBZUORRBIKRGG-XHSDSOJGSA-N |
| XLogP | 1.24 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |