C16H20FN3O2 — CID 56860604
(3R,7S,8aS)-7-[(2-fluoro-5-methylphenyl)methylamino]-3-methyl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 56860604) has the molecular formula C16H20FN3O2 and a molecular weight of 305.35 g/mol. Its IUPAC name is (3R,7S,8aS)-7-[(2-fluoro-5-methylphenyl)methylamino]-3-methyl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | (3R,7S,8aS)-7-[(2-fluoro-5-methylphenyl)methylamino]-3-methyl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 56860604 |
| Molecular Formula | C16H20FN3O2 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | (3R,7S,8aS)-7-[(2-fluoro-5-methylphenyl)methylamino]-3-methyl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | Cc1ccc(F)c(CN[C@H]2C[C@H]3C(=O)N[C@H](C)C(=O)N3C2)c1 |
| InChI | InChI=1S/C16H20FN3O2/c1-9-3-4-13(17)11(5-9)7-18-12-6-14-15(21)19-10(2)16(22)20(14)8-12/h3-5,10,12,14,18H,6-8H2,1-2H3,(H,19,21)/t10-,12+,14+/m1/s1 |
| InChIKey | BSJARMZTBHWQEU-OSMZGAPFSA-N |
| XLogP | 0.71 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |