C16H21N3O3S — CID 56860724
(7S,9aR)-7-(hydroxymethyl)-2-[(3-methylsulfanylphenyl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 56860724) has the molecular formula C16H21N3O3S and a molecular weight of 335.43 g/mol. Its IUPAC name is (7S,9aR)-7-(hydroxymethyl)-2-[(3-methylsulfanylphenyl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (7S,9aR)-7-(hydroxymethyl)-2-[(3-methylsulfanylphenyl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 56860724 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | (7S,9aR)-7-(hydroxymethyl)-2-[(3-methylsulfanylphenyl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | CSc1cccc(CN2CCN3C(=O)[C@H](CO)NC(=O)[C@H]3C2)c1 |
| InChI | InChI=1S/C16H21N3O3S/c1-23-12-4-2-3-11(7-12)8-18-5-6-19-14(9-18)15(21)17-13(10-20)16(19)22/h2-4,7,13-14,20H,5-6,8-10H2,1H3,(H,17,21)/t13-,14+/m0/s1 |
| InChIKey | JCYFBKSNAHCYJW-UONOGXRCSA-N |
| XLogP | -0.09 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |