About [5-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)imidazol-2-yl]furan-2-yl]methanol
[5-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)imidazol-2-yl]furan-2-yl]methanol (PubChem CID 56861091) has the molecular formula C17H16N2O4
and a molecular weight of 312.33 g/mol. Its IUPAC name is [5-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)imidazol-2-yl]furan-2-yl]methanol.
Molecular Properties
| Compound Name | [5-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)imidazol-2-yl]furan-2-yl]methanol |
| PubChem CID | 56861091 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | [5-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)imidazol-2-yl]furan-2-yl]methanol |
| SMILES | OCc1ccc(-c2nccn2CC2COc3ccccc3O2)o1 |
| InChI | InChI=1S/C17H16N2O4/c20-10-12-5-6-16(22-12)17-18-7-8-19(17)9-13-11-21-14-3-1-2-4-15(14)23-13/h1-8,13,20H,9-11H2 |
| InChIKey | BFTHCSHKIDLRJY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 69.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [5-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)imidazol-2-yl]furan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)imidazol-2-yl]furan-2-yl]methanol?
The IUPAC name of [5-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)imidazol-2-yl]furan-2-yl]methanol (CID 56861091) is [5-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)imidazol-2-yl]furan-2-yl]methanol.
What is the SMILES notation for [5-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)imidazol-2-yl]furan-2-yl]methanol?
The canonical SMILES for [5-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)imidazol-2-yl]furan-2-yl]methanol is OCc1ccc(-c2nccn2CC2COc3ccccc3O2)o1.
What is the InChIKey of [5-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)imidazol-2-yl]furan-2-yl]methanol?
The InChIKey is BFTHCSHKIDLRJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O4/c20-10-12-5-6-16(22-12)17-18-7-8-19(17)9-13-11-21-14-3-1-2-4-15(14)23-13/h1-8,13,20H,9-11H2.
What are the key properties of [5-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)imidazol-2-yl]furan-2-yl]methanol?
[5-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)imidazol-2-yl]furan-2-yl]methanol has a molecular weight of 312.33 g/mol, XLogP of 2.48, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[1-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)imidazol-2-yl]furan-2-yl]methanol is sourced from PubChem (CID 56861091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).