About N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2-methoxy-4-methyl-1,3-thiazole-5-carboxamide
N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2-methoxy-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 56861094) has the molecular formula C14H13N3O4S
and a molecular weight of 319.34 g/mol. Its IUPAC name is N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2-methoxy-4-methyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2-methoxy-4-methyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 56861094 |
| Molecular Formula | C14H13N3O4S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2-methoxy-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | COc1nc(C)c(C(=O)NCc2cc(-c3ccco3)on2)s1 |
| InChI | InChI=1S/C14H13N3O4S/c1-8-12(22-14(16-8)19-2)13(18)15-7-9-6-11(21-17-9)10-4-3-5-20-10/h3-6H,7H2,1-2H3,(H,15,18) |
| InChIKey | HKYHRMRTEDETOB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2-methoxy-4-methyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2-methoxy-4-methyl-1,3-thiazole-5-carboxamide?
The IUPAC name of N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2-methoxy-4-methyl-1,3-thiazole-5-carboxamide (CID 56861094) is N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2-methoxy-4-methyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2-methoxy-4-methyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2-methoxy-4-methyl-1,3-thiazole-5-carboxamide is COc1nc(C)c(C(=O)NCc2cc(-c3ccco3)on2)s1.
What is the InChIKey of N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2-methoxy-4-methyl-1,3-thiazole-5-carboxamide?
The InChIKey is HKYHRMRTEDETOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O4S/c1-8-12(22-14(16-8)19-2)13(18)15-7-9-6-11(21-17-9)10-4-3-5-20-10/h3-6H,7H2,1-2H3,(H,15,18).
What are the key properties of N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2-methoxy-4-methyl-1,3-thiazole-5-carboxamide?
N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2-methoxy-4-methyl-1,3-thiazole-5-carboxamide has a molecular weight of 319.34 g/mol, XLogP of 2.64, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2-methoxy-4-methyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 56861094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).