C14H13FN2 — CID 56861224
5-(3-fluoro-4-pyridinyl)-1,2,3,4-tetrahydroisoquinoline (PubChem CID 56861224) has the molecular formula C14H13FN2 and a molecular weight of 228.27 g/mol. Its IUPAC name is 5-(3-fluoro-4-pyridinyl)-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 5-(3-fluoro-4-pyridinyl)-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 56861224 |
| Molecular Formula | C14H13FN2 |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 5-(3-fluoro-4-pyridinyl)-1,2,3,4-tetrahydroisoquinoline |
| SMILES | Fc1cnccc1-c1cccc2c1CCNC2 |
| InChI | InChI=1S/C14H13FN2/c15-14-9-17-7-5-13(14)12-3-1-2-10-8-16-6-4-11(10)12/h1-3,5,7,9,16H,4,6,8H2 |
| InChIKey | PONAYBBQEOXWFA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |