About 2-[3-(furan-2-yl)-5-oxo-1H-1,2,4-triazol-4-yl]propanoic acid
2-[3-(furan-2-yl)-5-oxo-1H-1,2,4-triazol-4-yl]propanoic acid (PubChem CID 56861241) has the molecular formula C9H9N3O4
and a molecular weight of 223.19 g/mol. Its IUPAC name is 2-[3-(furan-2-yl)-5-oxo-1H-1,2,4-triazol-4-yl]propanoic acid.
Analyze 2-[3-(furan-2-yl)-5-oxo-1H-1,2,4-triazol-4-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(furan-2-yl)-5-oxo-1H-1,2,4-triazol-4-yl]propanoic acid?
The IUPAC name of 2-[3-(furan-2-yl)-5-oxo-1H-1,2,4-triazol-4-yl]propanoic acid (CID 56861241) is 2-[3-(furan-2-yl)-5-oxo-1H-1,2,4-triazol-4-yl]propanoic acid.
What is the SMILES notation for 2-[3-(furan-2-yl)-5-oxo-1H-1,2,4-triazol-4-yl]propanoic acid?
The canonical SMILES for 2-[3-(furan-2-yl)-5-oxo-1H-1,2,4-triazol-4-yl]propanoic acid is CC(C(=O)O)n1c(-c2ccco2)n[nH]c1=O.
What is the InChIKey of 2-[3-(furan-2-yl)-5-oxo-1H-1,2,4-triazol-4-yl]propanoic acid?
The InChIKey is BJPCQPXDSNUXEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O4/c1-5(8(13)14)12-7(10-11-9(12)15)6-3-2-4-16-6/h2-5H,1H3,(H,11,15)(H,13,14).
What are the key properties of 2-[3-(furan-2-yl)-5-oxo-1H-1,2,4-triazol-4-yl]propanoic acid?
2-[3-(furan-2-yl)-5-oxo-1H-1,2,4-triazol-4-yl]propanoic acid has a molecular weight of 223.19 g/mol, XLogP of 0.48, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(furan-2-yl)-5-oxo-1H-1,2,4-triazol-4-yl]propanoic acid is sourced from PubChem (CID 56861241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).