C17H22N4O2S — CID 56861583
1,2-dimethyl-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]imidazole-4-sulfonamide (PubChem CID 56861583) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is 1,2-dimethyl-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]imidazole-4-sulfonamide.
| Compound Name | 1,2-dimethyl-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 56861583 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 1,2-dimethyl-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]imidazole-4-sulfonamide |
| SMILES | Cc1cc(CNS(=O)(=O)c2cn(C)c(C)n2)c2[nH]c(C)c(C)c2c1 |
| InChI | InChI=1S/C17H22N4O2S/c1-10-6-14(17-15(7-10)11(2)12(3)19-17)8-18-24(22,23)16-9-21(5)13(4)20-16/h6-7,9,18-19H,8H2,1-5H3 |
| InChIKey | IXCCEUGTJJJNHA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|