C18H26N4O — CID 56862482
2-cyclohexyl-5-[1-(2-propan-2-yloxyethyl)imidazol-2-yl]pyrimidine (PubChem CID 56862482) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is 2-cyclohexyl-5-[1-(2-propan-2-yloxyethyl)imidazol-2-yl]pyrimidine.
| Compound Name | 2-cyclohexyl-5-[1-(2-propan-2-yloxyethyl)imidazol-2-yl]pyrimidine |
|---|---|
| PubChem CID | 56862482 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 2-cyclohexyl-5-[1-(2-propan-2-yloxyethyl)imidazol-2-yl]pyrimidine |
| SMILES | CC(C)OCCn1ccnc1-c1cnc(C2CCCCC2)nc1 |
| InChI | InChI=1S/C18H26N4O/c1-14(2)23-11-10-22-9-8-19-18(22)16-12-20-17(21-13-16)15-6-4-3-5-7-15/h8-9,12-15H,3-7,10-11H2,1-2H3 |
| InChIKey | XXRBNJIBLULEDW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |