C19H22N4O3 — CID 56862961
[(3aR,5S,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2-anilinopyrimidin-5-yl)methanone (PubChem CID 56862961) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is [(3aR,5S,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2-anilinopyrimidin-5-yl)methanone.
| Compound Name | [(3aR,5S,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2-anilinopyrimidin-5-yl)methanone |
|---|---|
| PubChem CID | 56862961 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | [(3aR,5S,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2-anilinopyrimidin-5-yl)methanone |
| SMILES | O=C(c1cnc(Nc2ccccc2)nc1)N1C[C@H]2C[C@H](O)[C@@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C19H22N4O3/c24-16-6-12-10-23(11-13(12)7-17(16)25)18(26)14-8-20-19(21-9-14)22-15-4-2-1-3-5-15/h1-5,8-9,12-13,16-17,24-25H,6-7,10-11H2,(H,20,21,22)/t12-,13+,16-,17-/m0/s1 |
| InChIKey | RAZXMDJRTSAJHU-RMHZUWNSSA-N |
| XLogP | 1.42 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |