C19H18ClFN4O — CID 56863305
(1R,9S)-5-amino-3-(6-chloro-2-fluoro-3-methoxyphenyl)-12-methyl-6,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-4-carbonitrile (PubChem CID 56863305) has the molecular formula C19H18ClFN4O and a molecular weight of 372.83 g/mol. Its IUPAC name is (1R,9S)-5-amino-3-(6-chloro-2-fluoro-3-methoxyphenyl)-12-methyl-6,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-4-carbonitrile.
| Compound Name | (1R,9S)-5-amino-3-(6-chloro-2-fluoro-3-methoxyphenyl)-12-methyl-6,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-4-carbonitrile |
|---|---|
| PubChem CID | 56863305 |
| Molecular Formula | C19H18ClFN4O |
| Molecular Weight | 372.83 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | (1R,9S)-5-amino-3-(6-chloro-2-fluoro-3-methoxyphenyl)-12-methyl-6,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-4-carbonitrile |
| SMILES | COc1ccc(Cl)c(-c2c(C#N)c(N)nc3c2[C@H]2CC[C@@H](C3)N2C)c1F |
| InChI | InChI=1S/C19H18ClFN4O/c1-25-9-3-5-13(25)17-12(7-9)24-19(23)10(8-22)15(17)16-11(20)4-6-14(26-2)18(16)21/h4,6,9,13H,3,5,7H2,1-2H3,(H2,23,24)/t9-,13+/m0/s1 |
| InChIKey | HGDVIEZTLSJKLR-TVQRCGJNSA-N |
| XLogP | 3.69 |
| TPSA | 75.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.83 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |