About 4-phenyl-2,3-dihydroazete
4-phenyl-2,3-dihydroazete (PubChem CID 568635) has the molecular formula C9H9N
and a molecular weight of 131.18 g/mol. Its IUPAC name is 4-phenyl-2,3-dihydroazete.
Molecular Properties
| Compound Name | 4-phenyl-2,3-dihydroazete |
| PubChem CID | 568635 |
| Molecular Formula | C9H9N |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.07 |
| IUPAC Name | 4-phenyl-2,3-dihydroazete |
| SMILES | c1ccc(C2=NCC2)cc1 |
| InChI | InChI=1S/C9H9N/c1-2-4-8(5-3-1)9-6-7-10-9/h1-5H,6-7H2 |
| InChIKey | HDSHTONAWOGQQH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-phenyl-2,3-dihydroazete with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-2,3-dihydroazete?
The IUPAC name of 4-phenyl-2,3-dihydroazete (CID 568635) is 4-phenyl-2,3-dihydroazete.
What is the SMILES notation for 4-phenyl-2,3-dihydroazete?
The canonical SMILES for 4-phenyl-2,3-dihydroazete is c1ccc(C2=NCC2)cc1.
What is the InChIKey of 4-phenyl-2,3-dihydroazete?
The InChIKey is HDSHTONAWOGQQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N/c1-2-4-8(5-3-1)9-6-7-10-9/h1-5H,6-7H2.
What are the key properties of 4-phenyl-2,3-dihydroazete?
4-phenyl-2,3-dihydroazete has a molecular weight of 131.18 g/mol, XLogP of 1.88, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-2,3-dihydroazete is sourced from PubChem (CID 568635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).