C13H18F3N3O — CID 56863545
N-(oxan-4-ylmethyl)-4-(3,3,3-trifluoropropyl)pyrimidin-2-amine (PubChem CID 56863545) has the molecular formula C13H18F3N3O and a molecular weight of 289.30 g/mol. Its IUPAC name is N-(oxan-4-ylmethyl)-4-(3,3,3-trifluoropropyl)pyrimidin-2-amine.
| Compound Name | N-(oxan-4-ylmethyl)-4-(3,3,3-trifluoropropyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 56863545 |
| Molecular Formula | C13H18F3N3O |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | N-(oxan-4-ylmethyl)-4-(3,3,3-trifluoropropyl)pyrimidin-2-amine |
| SMILES | FC(F)(F)CCc1ccnc(NCC2CCOCC2)n1 |
| InChI | InChI=1S/C13H18F3N3O/c14-13(15,16)5-1-11-2-6-17-12(19-11)18-9-10-3-7-20-8-4-10/h2,6,10H,1,3-5,7-9H2,(H,17,18,19) |
| InChIKey | GTIFPZQVFGYRMX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |