C19H17N5O — CID 56863575
14-(3-methylimidazo[1,5-a]pyridin-1-yl)-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one (PubChem CID 56863575) has the molecular formula C19H17N5O and a molecular weight of 331.38 g/mol. Its IUPAC name is 14-(3-methylimidazo[1,5-a]pyridin-1-yl)-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one.
| Compound Name | 14-(3-methylimidazo[1,5-a]pyridin-1-yl)-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one |
|---|---|
| PubChem CID | 56863575 |
| Molecular Formula | C19H17N5O |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 14-(3-methylimidazo[1,5-a]pyridin-1-yl)-2,8,11-triazatricyclo[7.5.0.02,7]tetradeca-1(9),3,5,7-tetraen-12-one |
| SMILES | Cc1nc(C2CC(=O)NCc3nc4ccccn4c32)c2ccccn12 |
| InChI | InChI=1S/C19H17N5O/c1-12-21-18(15-6-2-4-8-23(12)15)13-10-17(25)20-11-14-19(13)24-9-5-3-7-16(24)22-14/h2-9,13H,10-11H2,1H3,(H,20,25) |
| InChIKey | BGZMMWMLVHDIAG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 63.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |