About 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-N-[1-(3-fluoro-4-hydroxyphenyl)ethyl]acetamide
2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-N-[1-(3-fluoro-4-hydroxyphenyl)ethyl]acetamide (PubChem CID 56863849) has the molecular formula C17H22FN3O2
and a molecular weight of 319.38 g/mol. Its IUPAC name is 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-N-[1-(3-fluoro-4-hydroxyphenyl)ethyl]acetamide.
Molecular Properties
| Compound Name | 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-N-[1-(3-fluoro-4-hydroxyphenyl)ethyl]acetamide |
| PubChem CID | 56863849 |
| Molecular Formula | C17H22FN3O2 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-N-[1-(3-fluoro-4-hydroxyphenyl)ethyl]acetamide |
| SMILES | CCc1c(C)nn(CC(=O)NC(C)c2ccc(O)c(F)c2)c1C |
| InChI | InChI=1S/C17H22FN3O2/c1-5-14-11(3)20-21(12(14)4)9-17(23)19-10(2)13-6-7-16(22)15(18)8-13/h6-8,10,22H,5,9H2,1-4H3,(H,19,23) |
| InChIKey | ZPRFFRCCALIKHW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-N-[1-(3-fluoro-4-hydroxyphenyl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-N-[1-(3-fluoro-4-hydroxyphenyl)ethyl]acetamide?
The IUPAC name of 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-N-[1-(3-fluoro-4-hydroxyphenyl)ethyl]acetamide (CID 56863849) is 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-N-[1-(3-fluoro-4-hydroxyphenyl)ethyl]acetamide.
What is the SMILES notation for 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-N-[1-(3-fluoro-4-hydroxyphenyl)ethyl]acetamide?
The canonical SMILES for 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-N-[1-(3-fluoro-4-hydroxyphenyl)ethyl]acetamide is CCc1c(C)nn(CC(=O)NC(C)c2ccc(O)c(F)c2)c1C.
What is the InChIKey of 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-N-[1-(3-fluoro-4-hydroxyphenyl)ethyl]acetamide?
The InChIKey is ZPRFFRCCALIKHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22FN3O2/c1-5-14-11(3)20-21(12(14)4)9-17(23)19-10(2)13-6-7-16(22)15(18)8-13/h6-8,10,22H,5,9H2,1-4H3,(H,19,23).
What are the key properties of 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-N-[1-(3-fluoro-4-hydroxyphenyl)ethyl]acetamide?
2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-N-[1-(3-fluoro-4-hydroxyphenyl)ethyl]acetamide has a molecular weight of 319.38 g/mol, XLogP of 2.78, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)-N-[1-(3-fluoro-4-hydroxyphenyl)ethyl]acetamide is sourced from PubChem (CID 56863849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).