C17H22FNO3 — CID 56863969
1-[(3aR,5S,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-3-(4-fluorophenyl)propan-1-one (PubChem CID 56863969) has the molecular formula C17H22FNO3 and a molecular weight of 307.36 g/mol. Its IUPAC name is 1-[(3aR,5S,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-3-(4-fluorophenyl)propan-1-one.
| Compound Name | 1-[(3aR,5S,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-3-(4-fluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 56863969 |
| Molecular Formula | C17H22FNO3 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 1-[(3aR,5S,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-3-(4-fluorophenyl)propan-1-one |
| SMILES | O=C(CCc1ccc(F)cc1)N1C[C@H]2C[C@H](O)[C@@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C17H22FNO3/c18-14-4-1-11(2-5-14)3-6-17(22)19-9-12-7-15(20)16(21)8-13(12)10-19/h1-2,4-5,12-13,15-16,20-21H,3,6-10H2/t12-,13+,15-,16-/m0/s1 |
| InChIKey | LEVAVUVHXPVSRI-XRGAULLZSA-N |
| XLogP | 1.35 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |