C17H19N5O — CID 56864030
[(2R,6R)-2,6-bis(prop-2-enyl)-3,6-dihydro-2H-pyridin-1-yl]-(tetrazolo[1,5-a]pyridin-7-yl)methanone (PubChem CID 56864030) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is [(2R,6R)-2,6-bis(prop-2-enyl)-3,6-dihydro-2H-pyridin-1-yl]-(tetrazolo[1,5-a]pyridin-7-yl)methanone.
| Compound Name | [(2R,6R)-2,6-bis(prop-2-enyl)-3,6-dihydro-2H-pyridin-1-yl]-(tetrazolo[1,5-a]pyridin-7-yl)methanone |
|---|---|
| PubChem CID | 56864030 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | [(2R,6R)-2,6-bis(prop-2-enyl)-3,6-dihydro-2H-pyridin-1-yl]-(tetrazolo[1,5-a]pyridin-7-yl)methanone |
| SMILES | C=CC[C@@H]1CC=C[C@@H](CC=C)N1C(=O)c1ccn2nnnc2c1 |
| InChI | InChI=1S/C17H19N5O/c1-3-6-14-8-5-9-15(7-4-2)22(14)17(23)13-10-11-21-16(12-13)18-19-20-21/h3-5,8,10-12,14-15H,1-2,6-7,9H2/t14-,15-/m1/s1 |
| InChIKey | HXIMTDZUVAHEFA-HUUCEWRRSA-N |
| XLogP | 2.42 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|