C17H19F4NO4 — CID 56864114
[(3aR,5S,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone (PubChem CID 56864114) has the molecular formula C17H19F4NO4 and a molecular weight of 377.33 g/mol. Its IUPAC name is [(3aR,5S,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone.
| Compound Name | [(3aR,5S,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 56864114 |
| Molecular Formula | C17H19F4NO4 |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | [(3aR,5S,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone |
| SMILES | O=C(c1ccccc1OC(F)(F)C(F)F)N1C[C@H]2C[C@H](O)[C@@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C17H19F4NO4/c18-16(19)17(20,21)26-14-4-2-1-3-11(14)15(25)22-7-9-5-12(23)13(24)6-10(9)8-22/h1-4,9-10,12-13,16,23-24H,5-8H2/t9-,10+,12-,13-/m0/s1 |
| InChIKey | HHRZHRXNGKVHNB-LFSVMHDDSA-N |
| XLogP | 2.13 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|