C20H28N4O — CID 56864657
[(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-(4-methyl-2-piperidin-1-ylpyrimidin-5-yl)methanone (PubChem CID 56864657) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is [(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-(4-methyl-2-piperidin-1-ylpyrimidin-5-yl)methanone.
| Compound Name | [(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-(4-methyl-2-piperidin-1-ylpyrimidin-5-yl)methanone |
|---|---|
| PubChem CID | 56864657 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | [(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-(4-methyl-2-piperidin-1-ylpyrimidin-5-yl)methanone |
| SMILES | CC1=CC[C@@H]2CN(C(=O)c3cnc(N4CCCCC4)nc3C)C[C@@H]2C1 |
| InChI | InChI=1S/C20H28N4O/c1-14-6-7-16-12-24(13-17(16)10-14)19(25)18-11-21-20(22-15(18)2)23-8-4-3-5-9-23/h6,11,16-17H,3-5,7-10,12-13H2,1-2H3/t16-,17+/m1/s1 |
| InChIKey | DNEILXZECPRSOH-SJORKVTESA-N |
| XLogP | 3.20 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|