About methyl 6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazine-2-carboxylate
methyl 6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazine-2-carboxylate (PubChem CID 56865016) has the molecular formula C19H22N4O2
and a molecular weight of 338.41 g/mol. Its IUPAC name is methyl 6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazine-2-carboxylate |
| PubChem CID | 56865016 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | methyl 6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazine-2-carboxylate |
| SMILES | CCc1[nH]c2c(CNc3cncc(C(=O)OC)n3)cc(C)cc2c1C |
| InChI | InChI=1S/C19H22N4O2/c1-5-15-12(3)14-7-11(2)6-13(18(14)23-15)8-21-17-10-20-9-16(22-17)19(24)25-4/h6-7,9-10,23H,5,8H2,1-4H3,(H,21,22) |
| InChIKey | YDXHMBXQJAXKHL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazine-2-carboxylate?
The IUPAC name of methyl 6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazine-2-carboxylate (CID 56865016) is methyl 6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazine-2-carboxylate.
What is the SMILES notation for methyl 6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazine-2-carboxylate?
The canonical SMILES for methyl 6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazine-2-carboxylate is CCc1[nH]c2c(CNc3cncc(C(=O)OC)n3)cc(C)cc2c1C.
What is the InChIKey of methyl 6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazine-2-carboxylate?
The InChIKey is YDXHMBXQJAXKHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4O2/c1-5-15-12(3)14-7-11(2)6-13(18(14)23-15)8-21-17-10-20-9-16(22-17)19(24)25-4/h6-7,9-10,23H,5,8H2,1-4H3,(H,21,22).
What are the key properties of methyl 6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazine-2-carboxylate?
methyl 6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazine-2-carboxylate has a molecular weight of 338.41 g/mol, XLogP of 3.54, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazine-2-carboxylate is sourced from PubChem (CID 56865016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).