C19H21N3O — CID 56865081
[(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[4-(1H-pyrazol-5-yl)phenyl]methanone (PubChem CID 56865081) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is [(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[4-(1H-pyrazol-5-yl)phenyl]methanone.
| Compound Name | [(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[4-(1H-pyrazol-5-yl)phenyl]methanone |
|---|---|
| PubChem CID | 56865081 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | [(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-[4-(1H-pyrazol-5-yl)phenyl]methanone |
| SMILES | CC1=CC[C@@H]2CN(C(=O)c3ccc(-c4ccn[nH]4)cc3)C[C@@H]2C1 |
| InChI | InChI=1S/C19H21N3O/c1-13-2-3-16-11-22(12-17(16)10-13)19(23)15-6-4-14(5-7-15)18-8-9-20-21-18/h2,4-9,16-17H,3,10-12H2,1H3,(H,20,21)/t16-,17+/m1/s1 |
| InChIKey | GZCBBQCKTDFFHJ-SJORKVTESA-N |
| XLogP | 3.51 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|