About N-ethyl-N-[1-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]pyrrolidin-3-yl]acetamide
N-ethyl-N-[1-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]pyrrolidin-3-yl]acetamide (PubChem CID 56865162) has the molecular formula C15H21F3N4O
and a molecular weight of 330.35 g/mol. Its IUPAC name is N-ethyl-N-[1-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]pyrrolidin-3-yl]acetamide.
Molecular Properties
| Compound Name | N-ethyl-N-[1-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]pyrrolidin-3-yl]acetamide |
| PubChem CID | 56865162 |
| Molecular Formula | C15H21F3N4O |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | N-ethyl-N-[1-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]pyrrolidin-3-yl]acetamide |
| SMILES | CCN(C(C)=O)C1CCN(c2nccc(CCC(F)(F)F)n2)C1 |
| InChI | InChI=1S/C15H21F3N4O/c1-3-22(11(2)23)13-6-9-21(10-13)14-19-8-5-12(20-14)4-7-15(16,17)18/h5,8,13H,3-4,6-7,9-10H2,1-2H3 |
| InChIKey | ZKCAKQSPDFYMBJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethyl-N-[1-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]pyrrolidin-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-[1-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]pyrrolidin-3-yl]acetamide?
The IUPAC name of N-ethyl-N-[1-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]pyrrolidin-3-yl]acetamide (CID 56865162) is N-ethyl-N-[1-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]pyrrolidin-3-yl]acetamide.
What is the SMILES notation for N-ethyl-N-[1-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]pyrrolidin-3-yl]acetamide?
The canonical SMILES for N-ethyl-N-[1-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]pyrrolidin-3-yl]acetamide is CCN(C(C)=O)C1CCN(c2nccc(CCC(F)(F)F)n2)C1.
What is the InChIKey of N-ethyl-N-[1-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]pyrrolidin-3-yl]acetamide?
The InChIKey is ZKCAKQSPDFYMBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21F3N4O/c1-3-22(11(2)23)13-6-9-21(10-13)14-19-8-5-12(20-14)4-7-15(16,17)18/h5,8,13H,3-4,6-7,9-10H2,1-2H3.
What are the key properties of N-ethyl-N-[1-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]pyrrolidin-3-yl]acetamide?
N-ethyl-N-[1-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]pyrrolidin-3-yl]acetamide has a molecular weight of 330.35 g/mol, XLogP of 2.42, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-[1-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]pyrrolidin-3-yl]acetamide is sourced from PubChem (CID 56865162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).