About 3-phenyl-2H-1,2-oxazol-5-one
3-phenyl-2H-1,2-oxazol-5-one (PubChem CID 568654) has the molecular formula C9H7NO2
and a molecular weight of 161.16 g/mol. Its IUPAC name is 3-phenyl-2H-1,2-oxazol-5-one.
Molecular Properties
| Compound Name | 3-phenyl-2H-1,2-oxazol-5-one |
| PubChem CID | 568654 |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 3-phenyl-2H-1,2-oxazol-5-one |
| SMILES | O=c1cc(-c2ccccc2)[nH]o1 |
| InChI | InChI=1S/C9H7NO2/c11-9-6-8(10-12-9)7-4-2-1-3-5-7/h1-6,10H |
| InChIKey | JJZNCUHIYJBAMS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-phenyl-2H-1,2-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-2H-1,2-oxazol-5-one?
The IUPAC name of 3-phenyl-2H-1,2-oxazol-5-one (CID 568654) is 3-phenyl-2H-1,2-oxazol-5-one.
What is the SMILES notation for 3-phenyl-2H-1,2-oxazol-5-one?
The canonical SMILES for 3-phenyl-2H-1,2-oxazol-5-one is O=c1cc(-c2ccccc2)[nH]o1.
What is the InChIKey of 3-phenyl-2H-1,2-oxazol-5-one?
The InChIKey is JJZNCUHIYJBAMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2/c11-9-6-8(10-12-9)7-4-2-1-3-5-7/h1-6,10H.
What are the key properties of 3-phenyl-2H-1,2-oxazol-5-one?
3-phenyl-2H-1,2-oxazol-5-one has a molecular weight of 161.16 g/mol, XLogP of 1.63, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-2H-1,2-oxazol-5-one is sourced from PubChem (CID 568654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).