C14H16F3N5O2 — CID 56865816
(7R,8aS)-7-[[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]amino]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 56865816) has the molecular formula C14H16F3N5O2 and a molecular weight of 343.31 g/mol. Its IUPAC name is (7R,8aS)-7-[[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]amino]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | (7R,8aS)-7-[[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]amino]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 56865816 |
| Molecular Formula | C14H16F3N5O2 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | (7R,8aS)-7-[[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]amino]-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | O=C1NCC(=O)N2C[C@H](Nc3nccc(CCC(F)(F)F)n3)C[C@@H]12 |
| InChI | InChI=1S/C14H16F3N5O2/c15-14(16,17)3-1-8-2-4-18-13(20-8)21-9-5-10-12(24)19-6-11(23)22(10)7-9/h2,4,9-10H,1,3,5-7H2,(H,19,24)(H,18,20,21)/t9-,10+/m1/s1 |
| InChIKey | MHFGUQUODWTLHB-ZJUUUORDSA-N |
| XLogP | 0.48 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |