C16H25N7O — CID 56865873
5-methyl-N-[3-methyl-1-(2-methyl-1,2,4-triazol-3-yl)butyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxamide (PubChem CID 56865873) has the molecular formula C16H25N7O and a molecular weight of 331.42 g/mol. Its IUPAC name is 5-methyl-N-[3-methyl-1-(2-methyl-1,2,4-triazol-3-yl)butyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxamide.
| Compound Name | 5-methyl-N-[3-methyl-1-(2-methyl-1,2,4-triazol-3-yl)butyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 56865873 |
| Molecular Formula | C16H25N7O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | 5-methyl-N-[3-methyl-1-(2-methyl-1,2,4-triazol-3-yl)butyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxamide |
| SMILES | CC(C)CC(NC(=O)c1n[nH]c2c1CN(C)CC2)c1ncnn1C |
| InChI | InChI=1S/C16H25N7O/c1-10(2)7-13(15-17-9-18-23(15)4)19-16(24)14-11-8-22(3)6-5-12(11)20-21-14/h9-10,13H,5-8H2,1-4H3,(H,19,24)(H,20,21) |
| InChIKey | MRLMDVABVGUYAK-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |