C13H17F3N4 — CID 56866073
(3aR,6aS)-5-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 56866073) has the molecular formula C13H17F3N4 and a molecular weight of 286.30 g/mol. Its IUPAC name is (3aR,6aS)-5-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | (3aR,6aS)-5-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 56866073 |
| Molecular Formula | C13H17F3N4 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (3aR,6aS)-5-[4-(3,3,3-trifluoropropyl)pyrimidin-2-yl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | FC(F)(F)CCc1ccnc(N2C[C@H]3CNC[C@H]3C2)n1 |
| InChI | InChI=1S/C13H17F3N4/c14-13(15,16)3-1-11-2-4-18-12(19-11)20-7-9-5-17-6-10(9)8-20/h2,4,9-10,17H,1,3,5-8H2/t9-,10+ |
| InChIKey | OKQWYLKVAGLKBK-AOOOYVTPSA-N |
| XLogP | 1.63 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |