C18H25N3O — CID 56866361
[(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-(4-methyl-2-propan-2-ylpyrimidin-5-yl)methanone (PubChem CID 56866361) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is [(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-(4-methyl-2-propan-2-ylpyrimidin-5-yl)methanone.
| Compound Name | [(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-(4-methyl-2-propan-2-ylpyrimidin-5-yl)methanone |
|---|---|
| PubChem CID | 56866361 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | [(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-(4-methyl-2-propan-2-ylpyrimidin-5-yl)methanone |
| SMILES | CC1=CC[C@@H]2CN(C(=O)c3cnc(C(C)C)nc3C)C[C@@H]2C1 |
| InChI | InChI=1S/C18H25N3O/c1-11(2)17-19-8-16(13(4)20-17)18(22)21-9-14-6-5-12(3)7-15(14)10-21/h5,8,11,14-15H,6-7,9-10H2,1-4H3/t14-,15+/m1/s1 |
| InChIKey | IXDZSXIWIHEFSO-CABCVRRESA-N |
| XLogP | 3.34 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|