About 6-[[2-(5-methyl-1H-imidazol-4-yl)imidazol-1-yl]methyl]imidazo[2,1-b][1,3]thiazole
6-[[2-(5-methyl-1H-imidazol-4-yl)imidazol-1-yl]methyl]imidazo[2,1-b][1,3]thiazole (PubChem CID 56866851) has the molecular formula C13H12N6S
and a molecular weight of 284.35 g/mol. Its IUPAC name is 6-[[2-(5-methyl-1H-imidazol-4-yl)imidazol-1-yl]methyl]imidazo[2,1-b][1,3]thiazole.
Molecular Properties
| Compound Name | 6-[[2-(5-methyl-1H-imidazol-4-yl)imidazol-1-yl]methyl]imidazo[2,1-b][1,3]thiazole |
| PubChem CID | 56866851 |
| Molecular Formula | C13H12N6S |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 6-[[2-(5-methyl-1H-imidazol-4-yl)imidazol-1-yl]methyl]imidazo[2,1-b][1,3]thiazole |
| SMILES | Cc1[nH]cnc1-c1nccn1Cc1cn2ccsc2n1 |
| InChI | InChI=1S/C13H12N6S/c1-9-11(16-8-15-9)12-14-2-3-18(12)6-10-7-19-4-5-20-13(19)17-10/h2-5,7-8H,6H2,1H3,(H,15,16) |
| InChIKey | JYKOWDBMLLKQMK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 63.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[[2-(5-methyl-1H-imidazol-4-yl)imidazol-1-yl]methyl]imidazo[2,1-b][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[2-(5-methyl-1H-imidazol-4-yl)imidazol-1-yl]methyl]imidazo[2,1-b][1,3]thiazole?
The IUPAC name of 6-[[2-(5-methyl-1H-imidazol-4-yl)imidazol-1-yl]methyl]imidazo[2,1-b][1,3]thiazole (CID 56866851) is 6-[[2-(5-methyl-1H-imidazol-4-yl)imidazol-1-yl]methyl]imidazo[2,1-b][1,3]thiazole.
What is the SMILES notation for 6-[[2-(5-methyl-1H-imidazol-4-yl)imidazol-1-yl]methyl]imidazo[2,1-b][1,3]thiazole?
The canonical SMILES for 6-[[2-(5-methyl-1H-imidazol-4-yl)imidazol-1-yl]methyl]imidazo[2,1-b][1,3]thiazole is Cc1[nH]cnc1-c1nccn1Cc1cn2ccsc2n1.
What is the InChIKey of 6-[[2-(5-methyl-1H-imidazol-4-yl)imidazol-1-yl]methyl]imidazo[2,1-b][1,3]thiazole?
The InChIKey is JYKOWDBMLLKQMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N6S/c1-9-11(16-8-15-9)12-14-2-3-18(12)6-10-7-19-4-5-20-13(19)17-10/h2-5,7-8H,6H2,1H3,(H,15,16).
What are the key properties of 6-[[2-(5-methyl-1H-imidazol-4-yl)imidazol-1-yl]methyl]imidazo[2,1-b][1,3]thiazole?
6-[[2-(5-methyl-1H-imidazol-4-yl)imidazol-1-yl]methyl]imidazo[2,1-b][1,3]thiazole has a molecular weight of 284.35 g/mol, XLogP of 2.34, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[2-(5-methyl-1H-imidazol-4-yl)imidazol-1-yl]methyl]imidazo[2,1-b][1,3]thiazole is sourced from PubChem (CID 56866851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).