About 9-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-1-oxa-9-azaspiro[4.6]undecan-8-one
9-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-1-oxa-9-azaspiro[4.6]undecan-8-one (PubChem CID 56867345) has the molecular formula C14H21N3O3
and a molecular weight of 279.34 g/mol. Its IUPAC name is 9-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-1-oxa-9-azaspiro[4.6]undecan-8-one.
Molecular Properties
| Compound Name | 9-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-1-oxa-9-azaspiro[4.6]undecan-8-one |
| PubChem CID | 56867345 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 9-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-1-oxa-9-azaspiro[4.6]undecan-8-one |
| SMILES | CCc1nnc(CN2CCC3(CCCO3)CCC2=O)o1 |
| InChI | InChI=1S/C14H21N3O3/c1-2-11-15-16-12(20-11)10-17-8-7-14(5-3-9-19-14)6-4-13(17)18/h2-10H2,1H3 |
| InChIKey | YZHQQCMFPHRWPH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-1-oxa-9-azaspiro[4.6]undecan-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-1-oxa-9-azaspiro[4.6]undecan-8-one?
The IUPAC name of 9-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-1-oxa-9-azaspiro[4.6]undecan-8-one (CID 56867345) is 9-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-1-oxa-9-azaspiro[4.6]undecan-8-one.
What is the SMILES notation for 9-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-1-oxa-9-azaspiro[4.6]undecan-8-one?
The canonical SMILES for 9-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-1-oxa-9-azaspiro[4.6]undecan-8-one is CCc1nnc(CN2CCC3(CCCO3)CCC2=O)o1.
What is the InChIKey of 9-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-1-oxa-9-azaspiro[4.6]undecan-8-one?
The InChIKey is YZHQQCMFPHRWPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O3/c1-2-11-15-16-12(20-11)10-17-8-7-14(5-3-9-19-14)6-4-13(17)18/h2-10H2,1H3.
What are the key properties of 9-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-1-oxa-9-azaspiro[4.6]undecan-8-one?
9-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-1-oxa-9-azaspiro[4.6]undecan-8-one has a molecular weight of 279.34 g/mol, XLogP of 1.69, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-1-oxa-9-azaspiro[4.6]undecan-8-one is sourced from PubChem (CID 56867345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).