C16H24N4O2S — CID 56867771
N-(benzylsulfamoyl)-1-imidazol-1-yl-3,3-dimethylbutan-2-amine (PubChem CID 56867771) has the molecular formula C16H24N4O2S and a molecular weight of 336.46 g/mol. Its IUPAC name is N-(benzylsulfamoyl)-1-imidazol-1-yl-3,3-dimethylbutan-2-amine.
| Compound Name | N-(benzylsulfamoyl)-1-imidazol-1-yl-3,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 56867771 |
| Molecular Formula | C16H24N4O2S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | N-(benzylsulfamoyl)-1-imidazol-1-yl-3,3-dimethylbutan-2-amine |
| SMILES | CC(C)(C)C(Cn1ccnc1)NS(=O)(=O)NCc1ccccc1 |
| InChI | InChI=1S/C16H24N4O2S/c1-16(2,3)15(12-20-10-9-17-13-20)19-23(21,22)18-11-14-7-5-4-6-8-14/h4-10,13,15,18-19H,11-12H2,1-3H3 |
| InChIKey | VRKFPCSMMIYDPF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |