About 4-(cyclopropylmethyl)-3-propan-2-yl-1-[3-(tetrazol-1-yl)propanoyl]-1,4-diazepan-5-one
4-(cyclopropylmethyl)-3-propan-2-yl-1-[3-(tetrazol-1-yl)propanoyl]-1,4-diazepan-5-one (PubChem CID 56867867) has the molecular formula C16H26N6O2
and a molecular weight of 334.42 g/mol. Its IUPAC name is 4-(cyclopropylmethyl)-3-propan-2-yl-1-[3-(tetrazol-1-yl)propanoyl]-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 4-(cyclopropylmethyl)-3-propan-2-yl-1-[3-(tetrazol-1-yl)propanoyl]-1,4-diazepan-5-one |
| PubChem CID | 56867867 |
| Molecular Formula | C16H26N6O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 4-(cyclopropylmethyl)-3-propan-2-yl-1-[3-(tetrazol-1-yl)propanoyl]-1,4-diazepan-5-one |
| SMILES | CC(C)C1CN(C(=O)CCn2cnnn2)CCC(=O)N1CC1CC1 |
| InChI | InChI=1S/C16H26N6O2/c1-12(2)14-10-20(15(23)6-8-21-11-17-18-19-21)7-5-16(24)22(14)9-13-3-4-13/h11-14H,3-10H2,1-2H3 |
| InChIKey | HYEXMCTXLREHJO-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(cyclopropylmethyl)-3-propan-2-yl-1-[3-(tetrazol-1-yl)propanoyl]-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(cyclopropylmethyl)-3-propan-2-yl-1-[3-(tetrazol-1-yl)propanoyl]-1,4-diazepan-5-one?
The IUPAC name of 4-(cyclopropylmethyl)-3-propan-2-yl-1-[3-(tetrazol-1-yl)propanoyl]-1,4-diazepan-5-one (CID 56867867) is 4-(cyclopropylmethyl)-3-propan-2-yl-1-[3-(tetrazol-1-yl)propanoyl]-1,4-diazepan-5-one.
What is the SMILES notation for 4-(cyclopropylmethyl)-3-propan-2-yl-1-[3-(tetrazol-1-yl)propanoyl]-1,4-diazepan-5-one?
The canonical SMILES for 4-(cyclopropylmethyl)-3-propan-2-yl-1-[3-(tetrazol-1-yl)propanoyl]-1,4-diazepan-5-one is CC(C)C1CN(C(=O)CCn2cnnn2)CCC(=O)N1CC1CC1.
What is the InChIKey of 4-(cyclopropylmethyl)-3-propan-2-yl-1-[3-(tetrazol-1-yl)propanoyl]-1,4-diazepan-5-one?
The InChIKey is HYEXMCTXLREHJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N6O2/c1-12(2)14-10-20(15(23)6-8-21-11-17-18-19-21)7-5-16(24)22(14)9-13-3-4-13/h11-14H,3-10H2,1-2H3.
What are the key properties of 4-(cyclopropylmethyl)-3-propan-2-yl-1-[3-(tetrazol-1-yl)propanoyl]-1,4-diazepan-5-one?
4-(cyclopropylmethyl)-3-propan-2-yl-1-[3-(tetrazol-1-yl)propanoyl]-1,4-diazepan-5-one has a molecular weight of 334.42 g/mol, XLogP of 0.56, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(cyclopropylmethyl)-3-propan-2-yl-1-[3-(tetrazol-1-yl)propanoyl]-1,4-diazepan-5-one is sourced from PubChem (CID 56867867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).