About 2-[2-[2-(2,2-dimethyloxan-4-yl)imidazol-1-yl]ethyl]-4-methyl-6-(trifluoromethyl)pyrimidine
2-[2-[2-(2,2-dimethyloxan-4-yl)imidazol-1-yl]ethyl]-4-methyl-6-(trifluoromethyl)pyrimidine (PubChem CID 56867904) has the molecular formula C18H23F3N4O
and a molecular weight of 368.40 g/mol. Its IUPAC name is 2-[2-[2-(2,2-dimethyloxan-4-yl)imidazol-1-yl]ethyl]-4-methyl-6-(trifluoromethyl)pyrimidine.
Molecular Properties
| Compound Name | 2-[2-[2-(2,2-dimethyloxan-4-yl)imidazol-1-yl]ethyl]-4-methyl-6-(trifluoromethyl)pyrimidine |
| PubChem CID | 56867904 |
| Molecular Formula | C18H23F3N4O |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 2-[2-[2-(2,2-dimethyloxan-4-yl)imidazol-1-yl]ethyl]-4-methyl-6-(trifluoromethyl)pyrimidine |
| SMILES | Cc1cc(C(F)(F)F)nc(CCn2ccnc2C2CCOC(C)(C)C2)n1 |
| InChI | InChI=1S/C18H23F3N4O/c1-12-10-14(18(19,20)21)24-15(23-12)4-7-25-8-6-22-16(25)13-5-9-26-17(2,3)11-13/h6,8,10,13H,4-5,7,9,11H2,1-3H3 |
| InChIKey | LEXCJAWYICWUQB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-[2-(2,2-dimethyloxan-4-yl)imidazol-1-yl]ethyl]-4-methyl-6-(trifluoromethyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-(2,2-dimethyloxan-4-yl)imidazol-1-yl]ethyl]-4-methyl-6-(trifluoromethyl)pyrimidine?
The IUPAC name of 2-[2-[2-(2,2-dimethyloxan-4-yl)imidazol-1-yl]ethyl]-4-methyl-6-(trifluoromethyl)pyrimidine (CID 56867904) is 2-[2-[2-(2,2-dimethyloxan-4-yl)imidazol-1-yl]ethyl]-4-methyl-6-(trifluoromethyl)pyrimidine.
What is the SMILES notation for 2-[2-[2-(2,2-dimethyloxan-4-yl)imidazol-1-yl]ethyl]-4-methyl-6-(trifluoromethyl)pyrimidine?
The canonical SMILES for 2-[2-[2-(2,2-dimethyloxan-4-yl)imidazol-1-yl]ethyl]-4-methyl-6-(trifluoromethyl)pyrimidine is Cc1cc(C(F)(F)F)nc(CCn2ccnc2C2CCOC(C)(C)C2)n1.
What is the InChIKey of 2-[2-[2-(2,2-dimethyloxan-4-yl)imidazol-1-yl]ethyl]-4-methyl-6-(trifluoromethyl)pyrimidine?
The InChIKey is LEXCJAWYICWUQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23F3N4O/c1-12-10-14(18(19,20)21)24-15(23-12)4-7-25-8-6-22-16(25)13-5-9-26-17(2,3)11-13/h6,8,10,13H,4-5,7,9,11H2,1-3H3.
What are the key properties of 2-[2-[2-(2,2-dimethyloxan-4-yl)imidazol-1-yl]ethyl]-4-methyl-6-(trifluoromethyl)pyrimidine?
2-[2-[2-(2,2-dimethyloxan-4-yl)imidazol-1-yl]ethyl]-4-methyl-6-(trifluoromethyl)pyrimidine has a molecular weight of 368.40 g/mol, XLogP of 3.92, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-(2,2-dimethyloxan-4-yl)imidazol-1-yl]ethyl]-4-methyl-6-(trifluoromethyl)pyrimidine is sourced from PubChem (CID 56867904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).