About 3-[5-[1-[(2,6-difluoro-3-methylphenyl)methyl]imidazol-2-yl]thiophen-2-yl]prop-2-yn-1-ol
3-[5-[1-[(2,6-difluoro-3-methylphenyl)methyl]imidazol-2-yl]thiophen-2-yl]prop-2-yn-1-ol (PubChem CID 56867951) has the molecular formula C18H14F2N2OS
and a molecular weight of 344.39 g/mol. Its IUPAC name is 3-[5-[1-[(2,6-difluoro-3-methylphenyl)methyl]imidazol-2-yl]thiophen-2-yl]prop-2-yn-1-ol.
Molecular Properties
| Compound Name | 3-[5-[1-[(2,6-difluoro-3-methylphenyl)methyl]imidazol-2-yl]thiophen-2-yl]prop-2-yn-1-ol |
| PubChem CID | 56867951 |
| Molecular Formula | C18H14F2N2OS |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 3-[5-[1-[(2,6-difluoro-3-methylphenyl)methyl]imidazol-2-yl]thiophen-2-yl]prop-2-yn-1-ol |
| SMILES | Cc1ccc(F)c(Cn2ccnc2-c2ccc(C#CCO)s2)c1F |
| InChI | InChI=1S/C18H14F2N2OS/c1-12-4-6-15(19)14(17(12)20)11-22-9-8-21-18(22)16-7-5-13(24-16)3-2-10-23/h4-9,23H,10-11H2,1H3 |
| InChIKey | KPAIGYNBHOIXPN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[5-[1-[(2,6-difluoro-3-methylphenyl)methyl]imidazol-2-yl]thiophen-2-yl]prop-2-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-[1-[(2,6-difluoro-3-methylphenyl)methyl]imidazol-2-yl]thiophen-2-yl]prop-2-yn-1-ol?
The IUPAC name of 3-[5-[1-[(2,6-difluoro-3-methylphenyl)methyl]imidazol-2-yl]thiophen-2-yl]prop-2-yn-1-ol (CID 56867951) is 3-[5-[1-[(2,6-difluoro-3-methylphenyl)methyl]imidazol-2-yl]thiophen-2-yl]prop-2-yn-1-ol.
What is the SMILES notation for 3-[5-[1-[(2,6-difluoro-3-methylphenyl)methyl]imidazol-2-yl]thiophen-2-yl]prop-2-yn-1-ol?
The canonical SMILES for 3-[5-[1-[(2,6-difluoro-3-methylphenyl)methyl]imidazol-2-yl]thiophen-2-yl]prop-2-yn-1-ol is Cc1ccc(F)c(Cn2ccnc2-c2ccc(C#CCO)s2)c1F.
What is the InChIKey of 3-[5-[1-[(2,6-difluoro-3-methylphenyl)methyl]imidazol-2-yl]thiophen-2-yl]prop-2-yn-1-ol?
The InChIKey is KPAIGYNBHOIXPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14F2N2OS/c1-12-4-6-15(19)14(17(12)20)11-22-9-8-21-18(22)16-7-5-13(24-16)3-2-10-23/h4-9,23H,10-11H2,1H3.
What are the key properties of 3-[5-[1-[(2,6-difluoro-3-methylphenyl)methyl]imidazol-2-yl]thiophen-2-yl]prop-2-yn-1-ol?
3-[5-[1-[(2,6-difluoro-3-methylphenyl)methyl]imidazol-2-yl]thiophen-2-yl]prop-2-yn-1-ol has a molecular weight of 344.39 g/mol, XLogP of 3.59, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-[1-[(2,6-difluoro-3-methylphenyl)methyl]imidazol-2-yl]thiophen-2-yl]prop-2-yn-1-ol is sourced from PubChem (CID 56867951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).