About cyclopropyl-[4-(4-ethylpiperazin-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]methanone
cyclopropyl-[4-(4-ethylpiperazin-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]methanone (PubChem CID 56868241) has the molecular formula C17H25N5O
and a molecular weight of 315.42 g/mol. Its IUPAC name is cyclopropyl-[4-(4-ethylpiperazin-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]methanone.
Molecular Properties
| Compound Name | cyclopropyl-[4-(4-ethylpiperazin-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]methanone |
| PubChem CID | 56868241 |
| Molecular Formula | C17H25N5O |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | cyclopropyl-[4-(4-ethylpiperazin-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]methanone |
| SMILES | CCN1CCN(c2ncnc3c2CCN(C(=O)C2CC2)C3)CC1 |
| InChI | InChI=1S/C17H25N5O/c1-2-20-7-9-21(10-8-20)16-14-5-6-22(17(23)13-3-4-13)11-15(14)18-12-19-16/h12-13H,2-11H2,1H3 |
| InChIKey | TYBJLQCFTVYOMM-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclopropyl-[4-(4-ethylpiperazin-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl-[4-(4-ethylpiperazin-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]methanone?
The IUPAC name of cyclopropyl-[4-(4-ethylpiperazin-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]methanone (CID 56868241) is cyclopropyl-[4-(4-ethylpiperazin-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]methanone.
What is the SMILES notation for cyclopropyl-[4-(4-ethylpiperazin-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]methanone?
The canonical SMILES for cyclopropyl-[4-(4-ethylpiperazin-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]methanone is CCN1CCN(c2ncnc3c2CCN(C(=O)C2CC2)C3)CC1.
What is the InChIKey of cyclopropyl-[4-(4-ethylpiperazin-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]methanone?
The InChIKey is TYBJLQCFTVYOMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N5O/c1-2-20-7-9-21(10-8-20)16-14-5-6-22(17(23)13-3-4-13)11-15(14)18-12-19-16/h12-13H,2-11H2,1H3.
What are the key properties of cyclopropyl-[4-(4-ethylpiperazin-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]methanone?
cyclopropyl-[4-(4-ethylpiperazin-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]methanone has a molecular weight of 315.42 g/mol, XLogP of 0.91, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl-[4-(4-ethylpiperazin-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]methanone is sourced from PubChem (CID 56868241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).