C15H20N2OS — CID 56868352
[(3aR,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-(2-propyl-1,3-thiazol-4-yl)methanone (PubChem CID 56868352) has the molecular formula C15H20N2OS and a molecular weight of 276.40 g/mol. Its IUPAC name is [(3aR,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-(2-propyl-1,3-thiazol-4-yl)methanone.
| Compound Name | [(3aR,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-(2-propyl-1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 56868352 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | [(3aR,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-(2-propyl-1,3-thiazol-4-yl)methanone |
| SMILES | CCCc1nc(C(=O)N2C[C@H]3CC=CC[C@H]3C2)cs1 |
| InChI | InChI=1S/C15H20N2OS/c1-2-5-14-16-13(10-19-14)15(18)17-8-11-6-3-4-7-12(11)9-17/h3-4,10-12H,2,5-9H2,1H3/t11-,12+ |
| InChIKey | JLNFBLPZQZXPSZ-TXEJJXNPSA-N |
| XLogP | 3.13 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|