About [(3S,4R)-4-amino-3-methoxypiperidin-1-yl]-(5-phenyl-1H-pyrrol-2-yl)methanone
[(3S,4R)-4-amino-3-methoxypiperidin-1-yl]-(5-phenyl-1H-pyrrol-2-yl)methanone (PubChem CID 56868716) has the molecular formula C17H21N3O2
and a molecular weight of 299.37 g/mol. Its IUPAC name is [(3S,4R)-4-amino-3-methoxypiperidin-1-yl]-(5-phenyl-1H-pyrrol-2-yl)methanone.
Molecular Properties
| Compound Name | [(3S,4R)-4-amino-3-methoxypiperidin-1-yl]-(5-phenyl-1H-pyrrol-2-yl)methanone |
| PubChem CID | 56868716 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | [(3S,4R)-4-amino-3-methoxypiperidin-1-yl]-(5-phenyl-1H-pyrrol-2-yl)methanone |
| SMILES | CO[C@H]1CN(C(=O)c2ccc(-c3ccccc3)[nH]2)CC[C@H]1N |
| InChI | InChI=1S/C17H21N3O2/c1-22-16-11-20(10-9-13(16)18)17(21)15-8-7-14(19-15)12-5-3-2-4-6-12/h2-8,13,16,19H,9-11,18H2,1H3/t13-,16+/m1/s1 |
| InChIKey | KCKLLJKUORWCMI-CJNGLKHVSA-N |
| XLogP | 1.87 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3S,4R)-4-amino-3-methoxypiperidin-1-yl]-(5-phenyl-1H-pyrrol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4R)-4-amino-3-methoxypiperidin-1-yl]-(5-phenyl-1H-pyrrol-2-yl)methanone?
The IUPAC name of [(3S,4R)-4-amino-3-methoxypiperidin-1-yl]-(5-phenyl-1H-pyrrol-2-yl)methanone (CID 56868716) is [(3S,4R)-4-amino-3-methoxypiperidin-1-yl]-(5-phenyl-1H-pyrrol-2-yl)methanone.
What is the SMILES notation for [(3S,4R)-4-amino-3-methoxypiperidin-1-yl]-(5-phenyl-1H-pyrrol-2-yl)methanone?
The canonical SMILES for [(3S,4R)-4-amino-3-methoxypiperidin-1-yl]-(5-phenyl-1H-pyrrol-2-yl)methanone is CO[C@H]1CN(C(=O)c2ccc(-c3ccccc3)[nH]2)CC[C@H]1N.
What is the InChIKey of [(3S,4R)-4-amino-3-methoxypiperidin-1-yl]-(5-phenyl-1H-pyrrol-2-yl)methanone?
The InChIKey is KCKLLJKUORWCMI-CJNGLKHVSA-N. The full InChI is InChI=1S/C17H21N3O2/c1-22-16-11-20(10-9-13(16)18)17(21)15-8-7-14(19-15)12-5-3-2-4-6-12/h2-8,13,16,19H,9-11,18H2,1H3/t13-,16+/m1/s1.
What are the key properties of [(3S,4R)-4-amino-3-methoxypiperidin-1-yl]-(5-phenyl-1H-pyrrol-2-yl)methanone?
[(3S,4R)-4-amino-3-methoxypiperidin-1-yl]-(5-phenyl-1H-pyrrol-2-yl)methanone has a molecular weight of 299.37 g/mol, XLogP of 1.87, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4R)-4-amino-3-methoxypiperidin-1-yl]-(5-phenyl-1H-pyrrol-2-yl)methanone is sourced from PubChem (CID 56868716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).