C19H19N3O6 — CID 56868729
2-[[3-(2,3,4-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methoxy]benzamide (PubChem CID 56868729) has the molecular formula C19H19N3O6 and a molecular weight of 385.38 g/mol. Its IUPAC name is 2-[[3-(2,3,4-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methoxy]benzamide.
| Compound Name | 2-[[3-(2,3,4-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 56868729 |
| Molecular Formula | C19H19N3O6 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 2-[[3-(2,3,4-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methoxy]benzamide |
| SMILES | COc1ccc(-c2noc(COc3ccccc3C(N)=O)n2)c(OC)c1OC |
| InChI | InChI=1S/C19H19N3O6/c1-24-14-9-8-12(16(25-2)17(14)26-3)19-21-15(28-22-19)10-27-13-7-5-4-6-11(13)18(20)23/h4-9H,10H2,1-3H3,(H2,20,23) |
| InChIKey | RLHYBOSAFMTSAA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 118.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |