C21H22F2N2O2 — CID 56869067
2-[3-[2-(2,6-difluorophenyl)ethyl]piperidin-1-yl]-2-oxo-N-phenylacetamide (PubChem CID 56869067) has the molecular formula C21H22F2N2O2 and a molecular weight of 372.42 g/mol. Its IUPAC name is 2-[3-[2-(2,6-difluorophenyl)ethyl]piperidin-1-yl]-2-oxo-N-phenylacetamide.
| Compound Name | 2-[3-[2-(2,6-difluorophenyl)ethyl]piperidin-1-yl]-2-oxo-N-phenylacetamide |
|---|---|
| PubChem CID | 56869067 |
| Molecular Formula | C21H22F2N2O2 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 2-[3-[2-(2,6-difluorophenyl)ethyl]piperidin-1-yl]-2-oxo-N-phenylacetamide |
| SMILES | O=C(Nc1ccccc1)C(=O)N1CCCC(CCc2c(F)cccc2F)C1 |
| InChI | InChI=1S/C21H22F2N2O2/c22-18-9-4-10-19(23)17(18)12-11-15-6-5-13-25(14-15)21(27)20(26)24-16-7-2-1-3-8-16/h1-4,7-10,15H,5-6,11-14H2,(H,24,26) |
| InChIKey | FPMBHJZBKOGXQJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|